CCL

Összesen 1 találat.
#/oldal:
Részletezés:
Rendezés:

1.

001-es BibID:BIBFORM117713
035-os BibID:(Scopus)85180565931 (WoS)001146993900001
Első szerző:Mifsud, Duncan V.
Cím:Sulphur ion implantation into O2, CO, and CO2 ices: Implications for the formation of sulphur-bearing molecules in the Kuiper Belt / Duncan V. Mifsud, Zuzana Kaňuchová, Péter Herczku,Zoltán Juhász, Sándor T.S. Kovács,Gergő Lakatos, K.K. Rahul, Richárd Rácz, Béla Sulik, Sándor Biri, István Rajta, István Vajda, Sergio Ioppolo,Robert W. McCullough, Nigel J. Mason
Dátum:2024
ISSN:0019-1035
Megjegyzések:Previous experimental work has systematically investigated the radiolytic sulphur chemistry arising as a result of the implantation of reactive sulphur ions into various oxygen-bearing molecular ices (e.g., H2O, CO2) so as to better understand the surface chemistry of the Galilean moons of Jupiter, where sulphur ions are sourced from the giant Jovian magnetosphere. However, significantly less attention has been paid to analogous sulphur chemistry occurring under conditions relevant to the Kuiper Belt, where sulphur ions supplied by the solar wind may implant into the surfaces of icy bodies that are rich in volatile oxygen-bearing molecular ices such as O2, CO, or CO2. This paper presents the results of a study on the implantation of 290?400 keV S+ ions into pure O2, CO, and CO2 ices under temperature, pressure, radiation dose, and ice deposition conditions relevant to the Kuiper Belt, with a particular focus on the potential synthesis of simple inorganic sulphur-bearing molecules (e.g., SO2, OCS, CS2). Experiments involving CO2 ices were also performed at higher temperatures more typically associated with the Galilean moon system so as to determine whether there exist any differences in the chemistry resulting from the implantation of reactive sulphur ions in these two regions of the Solar System. Our results constitute the first systematic investigation of solid-phase sulphur chemistry in the Kuiper Belt mediated by the sulphur ion component of the solar wind, and thus represent an important step forward in our understanding of the astrochemical processes occurring in the outermost depths of the Solar System.
Tárgyszavak:Természettudományok Kémiai tudományok idegen nyelvű folyóiratközlemény külföldi lapban
folyóiratcikk
Astrochemistry
Ice
Infrared spectroscopy
Kuiper Belt
Sulphur
Megjelenés:Icarus. - 411 (2024), p. 1-12. -
További szerzők:Kaňuchová, Zuzana Herczku Péter (1982-) (fizikus) Juhász Zoltán (fizikus) Kovács Sándor T. S. (1986-) (környezetkutató-fizikus) Lakatos Gergő Rahul, K. K. Rácz Richárd (1985-) (fizikus) Sulik Béla (fizikus) Biri Sándor Rajta István (1970-) (fizikus) Vajda István (1973-) (okleveles fizikus) Ioppolo, Sergio McCullough, Robert W. Mason, Nigel J.
Pályázati támogatás:NKFIH K128621
Egyéb
Internet cím:Szerző által megadott URL
DOI
Intézményi repozitóriumban (DEA) tárolt változat
Borító:
Rekordok letöltése1